About 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one
2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one (PubChem CID 2919036) has the molecular formula C12H7F3O2S
and a molecular weight of 272.25 g/mol. Its IUPAC name is 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one |
| PubChem CID | 2919036 |
| Molecular Formula | C12H7F3O2S |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one |
| SMILES | O=c1oc2ccccc2c2c1SC(C(F)(F)F)C2 |
| InChI | InChI=1S/C12H7F3O2S/c13-12(14,15)9-5-7-6-3-1-2-4-8(6)17-11(16)10(7)18-9/h1-4,9H,5H2 |
| InChIKey | KFCJIZORNFTGBV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one?
The IUPAC name of 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one (CID 2919036) is 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one.
What is the SMILES notation for 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one?
The canonical SMILES for 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one is O=c1oc2ccccc2c2c1SC(C(F)(F)F)C2.
What is the InChIKey of 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one?
The InChIKey is KFCJIZORNFTGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F3O2S/c13-12(14,15)9-5-7-6-3-1-2-4-8(6)17-11(16)10(7)18-9/h1-4,9H,5H2.
What are the key properties of 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one?
2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one has a molecular weight of 272.25 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-1,2-dihydrothieno[2,3-c]chromen-4-one is sourced from PubChem (CID 2919036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).