C11H16N4O3 — CID 2919175
1,3,7-trimethyl-8-prop-2-enoxy-4,5-dihydropurine-2,6-dione (PubChem CID 2919175) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-prop-2-enoxy-4,5-dihydropurine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-prop-2-enoxy-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 2919175 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1,3,7-trimethyl-8-prop-2-enoxy-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCOC1=NC2C(C(=O)N(C)C(=O)N2C)N1C |
| InChI | InChI=1S/C11H16N4O3/c1-5-6-18-10-12-8-7(13(10)2)9(16)15(4)11(17)14(8)3/h5,7-8H,1,6H2,2-4H3 |
| InChIKey | GGCGDYYYQBUCPU-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|