C12H11F4NO3 — CID 2919229
3-(2-hydroxy-5-methylphenyl)-5-(1,1,2,2-tetrafluoroethyl)-4H-1,2-oxazol-5-ol (PubChem CID 2919229) has the molecular formula C12H11F4NO3 and a molecular weight of 293.22 g/mol. Its IUPAC name is 3-(2-hydroxy-5-methylphenyl)-5-(1,1,2,2-tetrafluoroethyl)-4H-1,2-oxazol-5-ol.
| Compound Name | 3-(2-hydroxy-5-methylphenyl)-5-(1,1,2,2-tetrafluoroethyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 2919229 |
| Molecular Formula | C12H11F4NO3 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-(2-hydroxy-5-methylphenyl)-5-(1,1,2,2-tetrafluoroethyl)-4H-1,2-oxazol-5-ol |
| SMILES | Cc1ccc(O)c(C2=NOC(O)(C(F)(F)C(F)F)C2)c1 |
| InChI | InChI=1S/C12H11F4NO3/c1-6-2-3-9(18)7(4-6)8-5-11(19,20-17-8)12(15,16)10(13)14/h2-4,10,18-19H,5H2,1H3 |
| InChIKey | DJNUOPNMJSYQLW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|