About 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one
4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one (PubChem CID 2919360) has the molecular formula C17H14ClNO4
and a molecular weight of 331.76 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one.
Molecular Properties
| Compound Name | 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one |
| PubChem CID | 2919360 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2ccccc2C12OCC(COc1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C17H14ClNO4/c18-11-5-7-12(8-6-11)21-9-13-10-22-17(23-13)14-3-1-2-4-15(14)19-16(17)20/h1-8,13H,9-10H2,(H,19,20) |
| InChIKey | ZNRLOLUWIKRVBI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one?
The IUPAC name of 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one (CID 2919360) is 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one.
What is the SMILES notation for 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one?
The canonical SMILES for 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one is O=C1Nc2ccccc2C12OCC(COc1ccc(Cl)cc1)O2.
What is the InChIKey of 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one?
The InChIKey is ZNRLOLUWIKRVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClNO4/c18-11-5-7-12(8-6-11)21-9-13-10-22-17(23-13)14-3-1-2-4-15(14)19-16(17)20/h1-8,13H,9-10H2,(H,19,20).
What are the key properties of 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one?
4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one has a molecular weight of 331.76 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chlorophenoxy)methyl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one is sourced from PubChem (CID 2919360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).