About trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate
trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate (PubChem CID 29194) has the molecular formula C6H8NNa3O7
and a molecular weight of 275.10 g/mol. Its IUPAC name is trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate.
Molecular Properties
| Compound Name | trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate |
| PubChem CID | 29194 |
| Molecular Formula | C6H8NNa3O7 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate |
| SMILES | O.O=C([O-])CN(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H9NO6.3Na.H2O/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;;1H2/q;3*+1;/p-3 |
| InChIKey | HERBOKBJKVUALN-UHFFFAOYSA-K |
| XLogP | -15.27 |
| TPSA | 155.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | -15.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate?
The IUPAC name of trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate (CID 29194) is trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate.
What is the SMILES notation for trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate?
The canonical SMILES for trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate is O.O=C([O-])CN(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate?
The InChIKey is HERBOKBJKVUALN-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H9NO6.3Na.H2O/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;;1H2/q;3*+1;/p-3.
What are the key properties of trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate?
trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate has a molecular weight of 275.10 g/mol, XLogP of -15.27, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;2-[bis(carboxylatomethyl)amino]acetate;hydrate is sourced from PubChem (CID 29194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).