C21H22N4O3 — CID 2919545
1-prop-2-enyl-5,5-bis(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 2919545) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-prop-2-enyl-5,5-bis(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-prop-2-enyl-5,5-bis(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2919545 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-prop-2-enyl-5,5-bis(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)C(CCc2ccncc2)(CCc2ccncc2)C1=O |
| InChI | InChI=1S/C21H22N4O3/c1-2-15-25-19(27)21(18(26)24-20(25)28,9-3-16-5-11-22-12-6-16)10-4-17-7-13-23-14-8-17/h2,5-8,11-14H,1,3-4,9-10,15H2,(H,24,26,28) |
| InChIKey | ZOCSOLYOIJMMEU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|