About [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone (PubChem CID 29196764) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone.
Molecular Properties
| Compound Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone |
| PubChem CID | 29196764 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone |
| SMILES | C[C@@H]1CN(C(=O)c2cc3ccccc3[nH]2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H18N2O2/c1-10-8-17(9-11(2)19-10)15(18)14-7-12-5-3-4-6-13(12)16-14/h3-7,10-11,16H,8-9H2,1-2H3/t10-,11+ |
| InChIKey | WTWRKFPCIYFYPU-PHIMTYICSA-N |
| XLogP | 2.42 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone?
The IUPAC name of [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone (CID 29196764) is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone.
What is the SMILES notation for [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone?
The canonical SMILES for [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone is C[C@@H]1CN(C(=O)c2cc3ccccc3[nH]2)C[C@H](C)O1.
What is the InChIKey of [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone?
The InChIKey is WTWRKFPCIYFYPU-PHIMTYICSA-N. The full InChI is InChI=1S/C15H18N2O2/c1-10-8-17(9-11(2)19-10)15(18)14-7-12-5-3-4-6-13(12)16-14/h3-7,10-11,16H,8-9H2,1-2H3/t10-,11+.
What are the key properties of [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone?
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone has a molecular weight of 258.32 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(1H-indol-2-yl)methanone is sourced from PubChem (CID 29196764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).