C20H27FN2O3S — CID 2919800
5-(dibutyl-lambda4-sulfanylidene)-1-[2-(4-fluorophenyl)ethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 2919800) has the molecular formula C20H27FN2O3S and a molecular weight of 394.51 g/mol. Its IUPAC name is 5-(dibutyl-lambda4-sulfanylidene)-1-[2-(4-fluorophenyl)ethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(dibutyl-lambda4-sulfanylidene)-1-[2-(4-fluorophenyl)ethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2919800 |
| Molecular Formula | C20H27FN2O3S |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 5-(dibutyl-lambda4-sulfanylidene)-1-[2-(4-fluorophenyl)ethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCS(CCCC)=C1C(=O)NC(=O)N(CCc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C20H27FN2O3S/c1-3-5-13-27(14-6-4-2)17-18(24)22-20(26)23(19(17)25)12-11-15-7-9-16(21)10-8-15/h7-10H,3-6,11-14H2,1-2H3,(H,22,24,26) |
| InChIKey | CUZWJYOXRGMVCW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|