C25H29N3O3 — CID 2920006
5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-[2-(cyclohexen-1-yl)ethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 2920006) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-[2-(cyclohexen-1-yl)ethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-[2-(cyclohexen-1-yl)ethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2920006 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-[2-(cyclohexen-1-yl)ethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(CCC2=CCCCC2)C(=O)C1=Cc1cc2c3c(c1)CCCN3CCC2 |
| InChI | InChI=1S/C25H29N3O3/c29-23-21(24(30)28(25(31)26-23)13-10-17-6-2-1-3-7-17)16-18-14-19-8-4-11-27-12-5-9-20(15-18)22(19)27/h6,14-16H,1-5,7-13H2,(H,26,29,31) |
| InChIKey | JDJIYHXJQCUAEM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|