C26H19NO4 — CID 2920063
3-(1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)benzoic acid (PubChem CID 2920063) has the molecular formula C26H19NO4 and a molecular weight of 409.44 g/mol. Its IUPAC name is 3-(1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)benzoic acid.
| Compound Name | 3-(1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)benzoic acid |
|---|---|
| PubChem CID | 2920063 |
| Molecular Formula | C26H19NO4 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 3-(1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)benzoic acid |
| SMILES | CC12c3ccccc3C(c3ccccc31)C1C(=O)N(c3cccc(C(=O)O)c3)C(=O)C12 |
| InChI | InChI=1S/C26H19NO4/c1-26-18-11-4-2-9-16(18)20(17-10-3-5-12-19(17)26)21-22(26)24(29)27(23(21)28)15-8-6-7-14(13-15)25(30)31/h2-13,20-22H,1H3,(H,30,31) |
| InChIKey | ALOBHKZKIFYQSA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|