C20H23N3O7 — CID 2920231
ethyl 7-methyl-2,4-dioxo-5-(3,4,5-trimethoxyphenyl)-5,8-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 2920231) has the molecular formula C20H23N3O7 and a molecular weight of 417.42 g/mol. Its IUPAC name is ethyl 7-methyl-2,4-dioxo-5-(3,4,5-trimethoxyphenyl)-5,8-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-methyl-2,4-dioxo-5-(3,4,5-trimethoxyphenyl)-5,8-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 2920231 |
| Molecular Formula | C20H23N3O7 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | ethyl 7-methyl-2,4-dioxo-5-(3,4,5-trimethoxyphenyl)-5,8-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2[nH]c(=O)[nH]c(=O)c2C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H23N3O7/c1-6-30-19(25)13-9(2)21-17-15(18(24)23-20(26)22-17)14(13)10-7-11(27-3)16(29-5)12(8-10)28-4/h7-8,14H,6H2,1-5H3,(H3,21,22,23,24,26) |
| InChIKey | ZECAFJMGYGHRQQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |