C26H28FN3O2 — CID 29208958
3-[(2S)-2-(2-fluorophenyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-N-(3-pyridin-4-ylpropyl)propanamide (PubChem CID 29208958) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is 3-[(2S)-2-(2-fluorophenyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-N-(3-pyridin-4-ylpropyl)propanamide.
| Compound Name | 3-[(2S)-2-(2-fluorophenyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-N-(3-pyridin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 29208958 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 3-[(2S)-2-(2-fluorophenyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-N-(3-pyridin-4-ylpropyl)propanamide |
| SMILES | O=C(CCN1Cc2ccccc2O[C@@H](c2ccccc2F)C1)NCCCc1ccncc1 |
| InChI | InChI=1S/C26H28FN3O2/c27-23-9-3-2-8-22(23)25-19-30(18-21-7-1-4-10-24(21)32-25)17-13-26(31)29-14-5-6-20-11-15-28-16-12-20/h1-4,7-12,15-16,25H,5-6,13-14,17-19H2,(H,29,31)/t25-/m1/s1 |
| InChIKey | MBEJAVWIJMWJNE-RUZDIDTESA-N |
| XLogP | 4.30 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|