About methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate
methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate (PubChem CID 29209032) has the molecular formula C21H29F3N2O3
and a molecular weight of 414.47 g/mol. Its IUPAC name is methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate |
| PubChem CID | 29209032 |
| Molecular Formula | C21H29F3N2O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CN(Cc2cccc(C(F)(F)F)c2)CC[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C21H29F3N2O3/c1-28-20(27)6-5-17-15-25(8-7-19(17)26-9-11-29-12-10-26)14-16-3-2-4-18(13-16)21(22,23)24/h2-4,13,17,19H,5-12,14-15H2,1H3/t17-,19+/m0/s1 |
| InChIKey | KBMOGDOPPSXWBI-PKOBYXMFSA-N |
| XLogP | 3.18 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate?
The IUPAC name of methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate (CID 29209032) is methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate.
What is the SMILES notation for methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate?
The canonical SMILES for methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate is COC(=O)CC[C@H]1CN(Cc2cccc(C(F)(F)F)c2)CC[C@H]1N1CCOCC1.
What is the InChIKey of methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate?
The InChIKey is KBMOGDOPPSXWBI-PKOBYXMFSA-N. The full InChI is InChI=1S/C21H29F3N2O3/c1-28-20(27)6-5-17-15-25(8-7-19(17)26-9-11-29-12-10-26)14-16-3-2-4-18(13-16)21(22,23)24/h2-4,13,17,19H,5-12,14-15H2,1H3/t17-,19+/m0/s1.
What are the key properties of methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate?
methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate has a molecular weight of 414.47 g/mol, XLogP of 3.18, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3S,4R)-4-morpholin-4-yl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]propanoate is sourced from PubChem (CID 29209032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).