About 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one
4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one (PubChem CID 2921040) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one.
Molecular Properties
| Compound Name | 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
| PubChem CID | 2921040 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
| SMILES | CC1CCOC2(O1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C12H13NO3/c1-8-6-7-15-12(16-8)9-4-2-3-5-10(9)13-11(12)14/h2-5,8H,6-7H2,1H3,(H,13,14) |
| InChIKey | CABHZQQZJZDWNZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The IUPAC name of 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one (CID 2921040) is 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one.
What is the SMILES notation for 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The canonical SMILES for 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one is CC1CCOC2(O1)C(=O)Nc1ccccc12.
What is the InChIKey of 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The InChIKey is CABHZQQZJZDWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-8-6-7-15-12(16-8)9-4-2-3-5-10(9)13-11(12)14/h2-5,8H,6-7H2,1H3,(H,13,14).
What are the key properties of 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one has a molecular weight of 219.24 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one is sourced from PubChem (CID 2921040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).