C14H6Cl2INO2S2 — CID 2921268
3-(3,4-dichlorophenyl)-5-[(5-iodofuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2921268) has the molecular formula C14H6Cl2INO2S2 and a molecular weight of 482.15 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-[(5-iodofuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(3,4-dichlorophenyl)-5-[(5-iodofuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2921268 |
| Molecular Formula | C14H6Cl2INO2S2 |
| Molecular Weight | 482.15 g/mol |
| Exact Mass | 480.83 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-[(5-iodofuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccc(I)o2)SC(=S)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H6Cl2INO2S2/c15-9-3-1-7(5-10(9)16)18-13(19)11(22-14(18)21)6-8-2-4-12(17)20-8/h1-6H |
| InChIKey | RQFNEEPHCCRAJH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.15 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|