C19H27FN4O — CID 29212798
2-[(2S)-4-[[1-(2-fluorophenyl)pyrazol-4-yl]methyl]-1-propan-2-ylpiperazin-2-yl]ethanol (PubChem CID 29212798) has the molecular formula C19H27FN4O and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-[(2S)-4-[[1-(2-fluorophenyl)pyrazol-4-yl]methyl]-1-propan-2-ylpiperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-4-[[1-(2-fluorophenyl)pyrazol-4-yl]methyl]-1-propan-2-ylpiperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 29212798 |
| Molecular Formula | C19H27FN4O |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 2-[(2S)-4-[[1-(2-fluorophenyl)pyrazol-4-yl]methyl]-1-propan-2-ylpiperazin-2-yl]ethanol |
| SMILES | CC(C)N1CCN(Cc2cnn(-c3ccccc3F)c2)C[C@@H]1CCO |
| InChI | InChI=1S/C19H27FN4O/c1-15(2)23-9-8-22(14-17(23)7-10-25)12-16-11-21-24(13-16)19-6-4-3-5-18(19)20/h3-6,11,13,15,17,25H,7-10,12,14H2,1-2H3/t17-/m0/s1 |
| InChIKey | MRBCARARFOYCTN-KRWDZBQOSA-N |
| XLogP | 2.29 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |