C18H18N6 — CID 2921355
N,N-dimethyl-4-(5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl)aniline (PubChem CID 2921355) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is N,N-dimethyl-4-(5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl)aniline.
| Compound Name | N,N-dimethyl-4-(5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl)aniline |
|---|---|
| PubChem CID | 2921355 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N,N-dimethyl-4-(5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl)aniline |
| SMILES | CN(C)c1ccc(C2C=C(c3ccccc3)Nc3nnnn32)cc1 |
| InChI | InChI=1S/C18H18N6/c1-23(2)15-10-8-14(9-11-15)17-12-16(13-6-4-3-5-7-13)19-18-20-21-22-24(17)18/h3-12,17H,1-2H3,(H,19,20,22) |
| InChIKey | SOWOKGYQZLNNFI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|