About 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride
4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride (PubChem CID 2921424) has the molecular formula C19H14ClN3O2S
and a molecular weight of 383.86 g/mol. Its IUPAC name is 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride |
| PubChem CID | 2921424 |
| Molecular Formula | C19H14ClN3O2S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(Nc2ncnc3scc(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C19H13N3O2S.ClH/c23-19(24)13-6-8-14(9-7-13)22-17-16-15(12-4-2-1-3-5-12)10-25-18(16)21-11-20-17;/h1-11H,(H,23,24)(H,20,21,22);1H |
| InChIKey | SLMLGCJGQMPCDV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride?
The IUPAC name of 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride (CID 2921424) is 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride.
What is the SMILES notation for 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride?
The canonical SMILES for 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride is Cl.O=C(O)c1ccc(Nc2ncnc3scc(-c4ccccc4)c23)cc1.
What is the InChIKey of 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride?
The InChIKey is SLMLGCJGQMPCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N3O2S.ClH/c23-19(24)13-6-8-14(9-7-13)22-17-16-15(12-4-2-1-3-5-12)10-25-18(16)21-11-20-17;/h1-11H,(H,23,24)(H,20,21,22);1H.
What are the key properties of 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride?
4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride has a molecular weight of 383.86 g/mol, XLogP of 5.22, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride is sourced from PubChem (CID 2921424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).