About 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one
5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one (PubChem CID 29215038) has the molecular formula C16H21N5O3
and a molecular weight of 331.38 g/mol. Its IUPAC name is 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one.
Molecular Properties
| Compound Name | 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one |
| PubChem CID | 29215038 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one |
| SMILES | CCc1noc(C)c1C(=O)N1CCN(c2cnn(C)c(=O)c2)CC1 |
| InChI | InChI=1S/C16H21N5O3/c1-4-13-15(11(2)24-18-13)16(23)21-7-5-20(6-8-21)12-9-14(22)19(3)17-10-12/h9-10H,4-8H2,1-3H3 |
| InChIKey | YNXOVPXZYRTGLN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 84.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one?
The IUPAC name of 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one (CID 29215038) is 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one.
What is the SMILES notation for 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one?
The canonical SMILES for 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one is CCc1noc(C)c1C(=O)N1CCN(c2cnn(C)c(=O)c2)CC1.
What is the InChIKey of 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one?
The InChIKey is YNXOVPXZYRTGLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5O3/c1-4-13-15(11(2)24-18-13)16(23)21-7-5-20(6-8-21)12-9-14(22)19(3)17-10-12/h9-10H,4-8H2,1-3H3.
What are the key properties of 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one?
5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one has a molecular weight of 331.38 g/mol, XLogP of 0.60, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]-2-methylpyridazin-3-one is sourced from PubChem (CID 29215038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).