About (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone
(3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone (PubChem CID 29215505) has the molecular formula C16H22N4O2
and a molecular weight of 302.38 g/mol. Its IUPAC name is (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone |
| PubChem CID | 29215505 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone |
| SMILES | CCc1noc(C)c1C(=O)N1CCC[C@@H](Cn2ccnc2)C1 |
| InChI | InChI=1S/C16H22N4O2/c1-3-14-15(12(2)22-18-14)16(21)20-7-4-5-13(10-20)9-19-8-6-17-11-19/h6,8,11,13H,3-5,7,9-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | OKGDKWXGOJDRLQ-ZDUSSCGKSA-N |
| XLogP | 2.29 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone?
The IUPAC name of (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone (CID 29215505) is (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone.
What is the SMILES notation for (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone?
The canonical SMILES for (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone is CCc1noc(C)c1C(=O)N1CCC[C@@H](Cn2ccnc2)C1.
What is the InChIKey of (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone?
The InChIKey is OKGDKWXGOJDRLQ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H22N4O2/c1-3-14-15(12(2)22-18-14)16(21)20-7-4-5-13(10-20)9-19-8-6-17-11-19/h6,8,11,13H,3-5,7,9-10H2,1-2H3/t13-/m0/s1.
What are the key properties of (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone?
(3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone has a molecular weight of 302.38 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-5-methyl-1,2-oxazol-4-yl)-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]methanone is sourced from PubChem (CID 29215505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).