C10H11N3OS — CID 29216
1-(1,3-benzothiazol-2-yl)-1,3-dimethylurea (PubChem CID 29216) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-1,3-dimethylurea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 29216 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H11N3OS/c1-11-9(14)13(2)10-12-7-5-3-4-6-8(7)15-10/h3-6H,1-2H3,(H,11,14) |
| InChIKey | RRVIAQKBTUQODI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |