About [4-(methylamino)phenyl] thiocyanate;hydrochloride
[4-(methylamino)phenyl] thiocyanate;hydrochloride (PubChem CID 2921744) has the molecular formula C8H9ClN2S
and a molecular weight of 200.69 g/mol. Its IUPAC name is [4-(methylamino)phenyl] thiocyanate;hydrochloride.
Molecular Properties
| Compound Name | [4-(methylamino)phenyl] thiocyanate;hydrochloride |
| PubChem CID | 2921744 |
| Molecular Formula | C8H9ClN2S |
| Molecular Weight | 200.69 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | [4-(methylamino)phenyl] thiocyanate;hydrochloride |
| SMILES | CNc1ccc(SC#N)cc1.Cl |
| InChI | InChI=1S/C8H8N2S.ClH/c1-10-7-2-4-8(5-3-7)11-6-9;/h2-5,10H,1H3;1H |
| InChIKey | PDIPRJJTIVTNEW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-(methylamino)phenyl] thiocyanate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methylamino)phenyl] thiocyanate;hydrochloride?
The IUPAC name of [4-(methylamino)phenyl] thiocyanate;hydrochloride (CID 2921744) is [4-(methylamino)phenyl] thiocyanate;hydrochloride.
What is the SMILES notation for [4-(methylamino)phenyl] thiocyanate;hydrochloride?
The canonical SMILES for [4-(methylamino)phenyl] thiocyanate;hydrochloride is CNc1ccc(SC#N)cc1.Cl.
What is the InChIKey of [4-(methylamino)phenyl] thiocyanate;hydrochloride?
The InChIKey is PDIPRJJTIVTNEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S.ClH/c1-10-7-2-4-8(5-3-7)11-6-9;/h2-5,10H,1H3;1H.
What are the key properties of [4-(methylamino)phenyl] thiocyanate;hydrochloride?
[4-(methylamino)phenyl] thiocyanate;hydrochloride has a molecular weight of 200.69 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methylamino)phenyl] thiocyanate;hydrochloride is sourced from PubChem (CID 2921744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).