C20H26N2O3S — CID 29217472
methyl 4-[[(3S)-3-(2-hydroxyethyl)-4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]benzoate (PubChem CID 29217472) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is methyl 4-[[(3S)-3-(2-hydroxyethyl)-4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(3S)-3-(2-hydroxyethyl)-4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 29217472 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | methyl 4-[[(3S)-3-(2-hydroxyethyl)-4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CCN(Cc3cccs3)[C@@H](CCO)C2)cc1 |
| InChI | InChI=1S/C20H26N2O3S/c1-25-20(24)17-6-4-16(5-7-17)13-21-9-10-22(18(14-21)8-11-23)15-19-3-2-12-26-19/h2-7,12,18,23H,8-11,13-15H2,1H3/t18-/m0/s1 |
| InChIKey | ZRAXCDJUIKMRST-SFHVURJKSA-N |
| XLogP | 2.60 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |