C13H13ClN2O4S2 — CID 2922037
3-[(4-chlorophenyl)sulfonylamino]-4-methylbenzenesulfonamide (PubChem CID 2922037) has the molecular formula C13H13ClN2O4S2 and a molecular weight of 360.84 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylamino]-4-methylbenzenesulfonamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2922037 |
| Molecular Formula | C13H13ClN2O4S2 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClN2O4S2/c1-9-2-5-12(21(15,17)18)8-13(9)16-22(19,20)11-6-3-10(14)4-7-11/h2-8,16H,1H3,(H2,15,17,18) |
| InChIKey | NKKRTEPKSOPCHN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |