C22H23N3O4 — CID 29220744
(E)-2-cyano-3-[3-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]prop-2-enamide (PubChem CID 29220744) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 29220744 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (E)-2-cyano-3-[3-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(N)=O)ccc1OCC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H23N3O4/c1-13-7-14(2)21(15(3)8-13)25-20(26)12-29-18-6-5-16(10-19(18)28-4)9-17(11-23)22(24)27/h5-10H,12H2,1-4H3,(H2,24,27)(H,25,26)/b17-9+ |
| InChIKey | CPALQLPPSUJLRC-RQZCQDPDSA-N |
| XLogP | 3.03 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|