C18H22N2O5 — CID 2922307
2-methoxyethyl 6-methyl-2-oxo-4-(4-prop-2-enoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 2922307) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-methoxyethyl 6-methyl-2-oxo-4-(4-prop-2-enoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 6-methyl-2-oxo-4-(4-prop-2-enoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2922307 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-methoxyethyl 6-methyl-2-oxo-4-(4-prop-2-enoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | C=CCOc1ccc(C2NC(=O)NC(C)=C2C(=O)OCCOC)cc1 |
| InChI | InChI=1S/C18H22N2O5/c1-4-9-24-14-7-5-13(6-8-14)16-15(12(2)19-18(22)20-16)17(21)25-11-10-23-3/h4-8,16H,1,9-11H2,2-3H3,(H2,19,20,22) |
| InChIKey | ZAGVHGVFZBMMND-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|