C14H15BrN2O — CID 29223796
1-(3-bromo-4-methoxyphenyl)-N-(pyridin-2-ylmethyl)methanamine (PubChem CID 29223796) has the molecular formula C14H15BrN2O and a molecular weight of 307.19 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-N-(pyridin-2-ylmethyl)methanamine.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-N-(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 29223796 |
| Molecular Formula | C14H15BrN2O |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-N-(pyridin-2-ylmethyl)methanamine |
| SMILES | COc1ccc(CNCc2ccccn2)cc1Br |
| InChI | InChI=1S/C14H15BrN2O/c1-18-14-6-5-11(8-13(14)15)9-16-10-12-4-2-3-7-17-12/h2-8,16H,9-10H2,1H3 |
| InChIKey | DZZWXCQHOFDMIH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |