C21H23ClN2O3 — CID 29224528
(2S)-2-[(5-chloro-2-propoxyphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 29224528) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is (2S)-2-[(5-chloro-2-propoxyphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[(5-chloro-2-propoxyphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 29224528 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2S)-2-[(5-chloro-2-propoxyphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CCCOc1ccc(Cl)cc1CN[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H23ClN2O3/c1-2-9-27-20-8-7-16(22)10-15(20)13-24-19(21(25)26)11-14-12-23-18-6-4-3-5-17(14)18/h3-8,10,12,19,23-24H,2,9,11,13H2,1H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | NQVBOBUAKWXIRD-IBGZPJMESA-N |
| XLogP | 4.40 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |