C16H21Cl2N3O — CID 29225349
N-[(3,5-dichloro-2-propoxyphenyl)methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 29225349) has the molecular formula C16H21Cl2N3O and a molecular weight of 342.27 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-propoxyphenyl)methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[(3,5-dichloro-2-propoxyphenyl)methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 29225349 |
| Molecular Formula | C16H21Cl2N3O |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[(3,5-dichloro-2-propoxyphenyl)methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | CCCOc1c(Cl)cc(Cl)cc1CNCCCn1ccnc1 |
| InChI | InChI=1S/C16H21Cl2N3O/c1-2-8-22-16-13(9-14(17)10-15(16)18)11-19-4-3-6-21-7-5-20-12-21/h5,7,9-10,12,19H,2-4,6,8,11H2,1H3 |
| InChIKey | DYSGZPQVKZKBKY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|