About 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide (PubChem CID 29225792) has the molecular formula C19H31N3O2S
and a molecular weight of 365.54 g/mol. Its IUPAC name is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide.
Molecular Properties
| Compound Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide |
| PubChem CID | 29225792 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide |
| SMILES | Cc1csc(=O)n1CCC(=O)NCC1(N2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C19H31N3O2S/c1-16-14-25-18(24)22(16)13-8-17(23)20-15-19(9-4-2-5-10-19)21-11-6-3-7-12-21/h14H,2-13,15H2,1H3,(H,20,23) |
| InChIKey | AAOHQWXRYZTYJX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide?
The IUPAC name of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide (CID 29225792) is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide.
What is the SMILES notation for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide?
The canonical SMILES for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide is Cc1csc(=O)n1CCC(=O)NCC1(N2CCCCC2)CCCCC1.
What is the InChIKey of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide?
The InChIKey is AAOHQWXRYZTYJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N3O2S/c1-16-14-25-18(24)22(16)13-8-17(23)20-15-19(9-4-2-5-10-19)21-11-6-3-7-12-21/h14H,2-13,15H2,1H3,(H,20,23).
What are the key properties of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide?
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide has a molecular weight of 365.54 g/mol, XLogP of 2.91, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide is sourced from PubChem (CID 29225792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).