C20H33N3O — CID 29230660
2-(4-methylpiperazin-1-yl)-N-[(1S)-2-methyl-1-(4-propan-2-ylphenyl)propyl]acetamide (PubChem CID 29230660) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-N-[(1S)-2-methyl-1-(4-propan-2-ylphenyl)propyl]acetamide.
| Compound Name | 2-(4-methylpiperazin-1-yl)-N-[(1S)-2-methyl-1-(4-propan-2-ylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 29230660 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-N-[(1S)-2-methyl-1-(4-propan-2-ylphenyl)propyl]acetamide |
| SMILES | CC(C)c1ccc([C@@H](NC(=O)CN2CCN(C)CC2)C(C)C)cc1 |
| InChI | InChI=1S/C20H33N3O/c1-15(2)17-6-8-18(9-7-17)20(16(3)4)21-19(24)14-23-12-10-22(5)11-13-23/h6-9,15-16,20H,10-14H2,1-5H3,(H,21,24)/t20-/m0/s1 |
| InChIKey | CZKCUSXMJUXNJW-FQEVSTJZSA-N |
| XLogP | 2.87 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |