About [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate
[[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate (PubChem CID 2923579) has the molecular formula C13H11N3O4S
and a molecular weight of 305.31 g/mol. Its IUPAC name is [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate.
Molecular Properties
| Compound Name | [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate |
| PubChem CID | 2923579 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate |
| SMILES | NC(=NOC(=O)Cc1cccs1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H11N3O4S/c14-13(9-3-5-10(6-4-9)16(18)19)15-20-12(17)8-11-2-1-7-21-11/h1-7H,8H2,(H2,14,15) |
| InChIKey | KVFICKQAEHURRP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate?
The IUPAC name of [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate (CID 2923579) is [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate.
What is the SMILES notation for [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate?
The canonical SMILES for [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate is NC(=NOC(=O)Cc1cccs1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate?
The InChIKey is KVFICKQAEHURRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O4S/c14-13(9-3-5-10(6-4-9)16(18)19)15-20-12(17)8-11-2-1-7-21-11/h1-7H,8H2,(H2,14,15).
What are the key properties of [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate?
[[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate has a molecular weight of 305.31 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(4-nitrophenyl)methylidene]amino] 2-thiophen-2-ylacetate is sourced from PubChem (CID 2923579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).