About 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid
1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid (PubChem CID 2923730) has the molecular formula C15H20Cl2N2O5
and a molecular weight of 379.24 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid.
Molecular Properties
| Compound Name | 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid |
| PubChem CID | 2923730 |
| Molecular Formula | C15H20Cl2N2O5 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid |
| SMILES | CN1CCN(CCOc2ccc(Cl)c(Cl)c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H18Cl2N2O.C2H2O4/c1-16-4-6-17(7-5-16)8-9-18-11-2-3-12(14)13(15)10-11;3-1(4)2(5)6/h2-3,10H,4-9H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ALWCYQLKLJVQEU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid?
The IUPAC name of 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid (CID 2923730) is 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid.
What is the SMILES notation for 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid?
The canonical SMILES for 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid is CN1CCN(CCOc2ccc(Cl)c(Cl)c2)CC1.O=C(O)C(=O)O.
What is the InChIKey of 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid?
The InChIKey is ALWCYQLKLJVQEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl2N2O.C2H2O4/c1-16-4-6-17(7-5-16)8-9-18-11-2-3-12(14)13(15)10-11;3-1(4)2(5)6/h2-3,10H,4-9H2,1H3;(H,3,4)(H,5,6).
What are the key properties of 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid?
1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid has a molecular weight of 379.24 g/mol, XLogP of 1.78, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperazine;oxalic acid is sourced from PubChem (CID 2923730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).