About oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine
oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine (PubChem CID 2923755) has the molecular formula C22H27NO7
and a molecular weight of 417.46 g/mol. Its IUPAC name is oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine.
Molecular Properties
| Compound Name | oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine |
| PubChem CID | 2923755 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine |
| SMILES | O=C(O)C(=O)O.c1ccc(-c2ccccc2OCCOCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C20H25NO3.C2H2O4/c1-2-6-18(7-3-1)19-8-4-5-9-20(19)24-17-16-23-15-12-21-10-13-22-14-11-21;3-1(4)2(5)6/h1-9H,10-17H2;(H,3,4)(H,5,6) |
| InChIKey | JFZSLZKFABJBNT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine?
The IUPAC name of oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine (CID 2923755) is oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine.
What is the SMILES notation for oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine?
The canonical SMILES for oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine is O=C(O)C(=O)O.c1ccc(-c2ccccc2OCCOCCN2CCOCC2)cc1.
What is the InChIKey of oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine?
The InChIKey is JFZSLZKFABJBNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO3.C2H2O4/c1-2-6-18(7-3-1)19-8-4-5-9-20(19)24-17-16-23-15-12-21-10-13-22-14-11-21;3-1(4)2(5)6/h1-9H,10-17H2;(H,3,4)(H,5,6).
What are the key properties of oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine?
oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine has a molecular weight of 417.46 g/mol, XLogP of 2.24, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine is sourced from PubChem (CID 2923755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).