About 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide
1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide (PubChem CID 29240913) has the molecular formula C15H18N2O3
and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide |
| PubChem CID | 29240913 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(C#N)CCCC2)cc1OC |
| InChI | InChI=1S/C15H18N2O3/c1-19-12-6-5-11(9-13(12)20-2)17-14(18)15(10-16)7-3-4-8-15/h5-6,9H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | JHSNKUJPOFBESK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide?
The IUPAC name of 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide (CID 29240913) is 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide.
What is the SMILES notation for 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide?
The canonical SMILES for 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide is COc1ccc(NC(=O)C2(C#N)CCCC2)cc1OC.
What is the InChIKey of 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide?
The InChIKey is JHSNKUJPOFBESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c1-19-12-6-5-11(9-13(12)20-2)17-14(18)15(10-16)7-3-4-8-15/h5-6,9H,3-4,7-8H2,1-2H3,(H,17,18).
What are the key properties of 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide?
1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide has a molecular weight of 274.32 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide is sourced from PubChem (CID 29240913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).