C21H23N3O7S2 — CID 2924144
N-(1,1-dioxothiolan-3-yl)-2-[[2-(2-nitrophenoxy)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 2924144) has the molecular formula C21H23N3O7S2 and a molecular weight of 493.56 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[[2-(2-nitrophenoxy)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[[2-(2-nitrophenoxy)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 2924144 |
| Molecular Formula | C21H23N3O7S2 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[[2-(2-nitrophenoxy)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])Nc1sc2c(c1C(=O)NC1CCS(=O)(=O)C1)CCCC2 |
| InChI | InChI=1S/C21H23N3O7S2/c25-18(11-31-16-7-3-2-6-15(16)24(27)28)23-21-19(14-5-1-4-8-17(14)32-21)20(26)22-13-9-10-33(29,30)12-13/h2-3,6-7,13H,1,4-5,8-12H2,(H,22,26)(H,23,25) |
| InChIKey | UJXLEWQLSCXENY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|