C18H14BrN5O3S — CID 2924262
10-bromo-3-ethylsulfanyl-6-(2-nitrophenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 2924262) has the molecular formula C18H14BrN5O3S and a molecular weight of 460.31 g/mol. Its IUPAC name is 10-bromo-3-ethylsulfanyl-6-(2-nitrophenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 10-bromo-3-ethylsulfanyl-6-(2-nitrophenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 2924262 |
| Molecular Formula | C18H14BrN5O3S |
| Molecular Weight | 460.31 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | 10-bromo-3-ethylsulfanyl-6-(2-nitrophenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCSc1nnc2c(n1)OC(c1ccccc1[N+](=O)[O-])Nc1ccc(Br)cc1-2 |
| InChI | InChI=1S/C18H14BrN5O3S/c1-2-28-18-21-17-15(22-23-18)12-9-10(19)7-8-13(12)20-16(27-17)11-5-3-4-6-14(11)24(25)26/h3-9,16,20H,2H2,1H3 |
| InChIKey | OOTSPTDYHSQICF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|