C19H13Cl2NO5S2 — CID 2924268
2-[4-[[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 2924268) has the molecular formula C19H13Cl2NO5S2 and a molecular weight of 470.36 g/mol. Its IUPAC name is 2-[4-[[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 2924268 |
| Molecular Formula | C19H13Cl2NO5S2 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 468.96 |
| IUPAC Name | 2-[4-[[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C=C2SC(=S)N(c3ccc(Cl)cc3Cl)C2=O)ccc1OCC(=O)O |
| InChI | InChI=1S/C19H13Cl2NO5S2/c1-26-15-6-10(2-5-14(15)27-9-17(23)24)7-16-18(25)22(19(28)29-16)13-4-3-11(20)8-12(13)21/h2-8H,9H2,1H3,(H,23,24) |
| InChIKey | FREATLCQFIGACA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|