About 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride
2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride (PubChem CID 29247) has the molecular formula C20H27ClN2O2
and a molecular weight of 362.90 g/mol. Its IUPAC name is 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride.
Molecular Properties
| Compound Name | 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride |
| PubChem CID | 29247 |
| Molecular Formula | C20H27ClN2O2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride |
| SMILES | CCOC(C(=O)NCC[NH+](C)C)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H26N2O2.ClH/c1-4-24-20(17-11-7-5-8-12-17,18-13-9-6-10-14-18)19(23)21-15-16-22(2)3;/h5-14H,4,15-16H2,1-3H3,(H,21,23);1H |
| InChIKey | NSNAOWRGMCASGZ-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride?
The IUPAC name of 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride (CID 29247) is 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride.
What is the SMILES notation for 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride?
The canonical SMILES for 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride is CCOC(C(=O)NCC[NH+](C)C)(c1ccccc1)c1ccccc1.[Cl-].
What is the InChIKey of 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride?
The InChIKey is NSNAOWRGMCASGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O2.ClH/c1-4-24-20(17-11-7-5-8-12-17,18-13-9-6-10-14-18)19(23)21-15-16-22(2)3;/h5-14H,4,15-16H2,1-3H3,(H,21,23);1H.
What are the key properties of 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride?
2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride has a molecular weight of 362.90 g/mol, XLogP of -1.77, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-ethoxy-2,2-diphenylacetyl)amino]ethyl-dimethylazanium chloride is sourced from PubChem (CID 29247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).