C26H28N2O3 — CID 2924797
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenyl-N-(1-phenylethyl)propanamide (PubChem CID 2924797) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenyl-N-(1-phenylethyl)propanamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenyl-N-(1-phenylethyl)propanamide |
|---|---|
| PubChem CID | 2924797 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenyl-N-(1-phenylethyl)propanamide |
| SMILES | CC(NC(=O)C(Cc1ccccc1)N1C(=O)C2C3CCC(C3)C2C1=O)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O3/c1-16(18-10-6-3-7-11-18)27-24(29)21(14-17-8-4-2-5-9-17)28-25(30)22-19-12-13-20(15-19)23(22)26(28)31/h2-11,16,19-23H,12-15H2,1H3,(H,27,29) |
| InChIKey | LOAFSWHUOUKUPQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|