C19H21N3S — CID 2924850
6,6-dimethyl-1,2-diphenyl-5,7-dihydro-1H-pyrazolo[1,2-a][1,2,4]triazole-3-thione (PubChem CID 2924850) has the molecular formula C19H21N3S and a molecular weight of 323.47 g/mol. Its IUPAC name is 6,6-dimethyl-1,2-diphenyl-5,7-dihydro-1H-pyrazolo[1,2-a][1,2,4]triazole-3-thione.
| Compound Name | 6,6-dimethyl-1,2-diphenyl-5,7-dihydro-1H-pyrazolo[1,2-a][1,2,4]triazole-3-thione |
|---|---|
| PubChem CID | 2924850 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 6,6-dimethyl-1,2-diphenyl-5,7-dihydro-1H-pyrazolo[1,2-a][1,2,4]triazole-3-thione |
| SMILES | CC1(C)CN2C(=S)N(c3ccccc3)C(c3ccccc3)N2C1 |
| InChI | InChI=1S/C19H21N3S/c1-19(2)13-20-17(15-9-5-3-6-10-15)22(18(23)21(20)14-19)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3 |
| InChIKey | QDRVEILXRSWJSO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|