C23H19ClN2O3 — CID 2924851
N-(5-chloro-2-methylphenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzamide (PubChem CID 2924851) has the molecular formula C23H19ClN2O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzamide |
|---|---|
| PubChem CID | 2924851 |
| Molecular Formula | C23H19ClN2O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)c1cccc(N2C(=O)C3C4C=CC(C4)C3C2=O)c1 |
| InChI | InChI=1S/C23H19ClN2O3/c1-12-5-8-16(24)11-18(12)25-21(27)15-3-2-4-17(10-15)26-22(28)19-13-6-7-14(9-13)20(19)23(26)29/h2-8,10-11,13-14,19-20H,9H2,1H3,(H,25,27) |
| InChIKey | XHUBEDLTEFAYSG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|