C23H26Cl2N4O3 — CID 2925185
N-[2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]ethyl]-N'-(3,4-dimethylphenyl)oxamide (PubChem CID 2925185) has the molecular formula C23H26Cl2N4O3 and a molecular weight of 477.39 g/mol. Its IUPAC name is N-[2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]ethyl]-N'-(3,4-dimethylphenyl)oxamide.
| Compound Name | N-[2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]ethyl]-N'-(3,4-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 2925185 |
| Molecular Formula | C23H26Cl2N4O3 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-[2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]ethyl]-N'-(3,4-dimethylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCCN2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)cc1C |
| InChI | InChI=1S/C23H26Cl2N4O3/c1-15-3-5-18(13-16(15)2)27-22(31)21(30)26-7-8-28-9-11-29(12-10-28)23(32)19-6-4-17(24)14-20(19)25/h3-6,13-14H,7-12H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | CXVNUMMPRIIRGH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|