C21H19NO9 — CID 2925228
[acetyloxy-[2-(1,3-benzodioxol-5-yl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-4-yl]methyl] acetate (PubChem CID 2925228) has the molecular formula C21H19NO9 and a molecular weight of 429.38 g/mol. Its IUPAC name is [acetyloxy-[2-(1,3-benzodioxol-5-yl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-4-yl]methyl] acetate.
| Compound Name | [acetyloxy-[2-(1,3-benzodioxol-5-yl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-4-yl]methyl] acetate |
|---|---|
| PubChem CID | 2925228 |
| Molecular Formula | C21H19NO9 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | [acetyloxy-[2-(1,3-benzodioxol-5-yl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-4-yl]methyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)C12C=CC(C)(O1)C1C(=O)N(c3ccc4c(c3)OCO4)C(=O)C12 |
| InChI | InChI=1S/C21H19NO9/c1-10(23)29-19(30-11(2)24)21-7-6-20(3,31-21)15-16(21)18(26)22(17(15)25)12-4-5-13-14(8-12)28-9-27-13/h4-8,15-16,19H,9H2,1-3H3 |
| InChIKey | JYIPTUZFIYWGCV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|