C21H22N2O2 — CID 2925330
5-methyl-2-[4-(pyridin-4-ylmethyl)phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 2925330) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 5-methyl-2-[4-(pyridin-4-ylmethyl)phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 5-methyl-2-[4-(pyridin-4-ylmethyl)phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2925330 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 5-methyl-2-[4-(pyridin-4-ylmethyl)phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC1CCC2C(=O)N(c3ccc(Cc4ccncc4)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C21H22N2O2/c1-14-2-7-18-19(12-14)21(25)23(20(18)24)17-5-3-15(4-6-17)13-16-8-10-22-11-9-16/h3-6,8-11,14,18-19H,2,7,12-13H2,1H3 |
| InChIKey | RJHNCKCYNUVAMZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|