C22H20BrNO4 — CID 2925339
(4-bromophenyl) 2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate (PubChem CID 2925339) has the molecular formula C22H20BrNO4 and a molecular weight of 442.31 g/mol. Its IUPAC name is (4-bromophenyl) 2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate.
| Compound Name | (4-bromophenyl) 2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 2925339 |
| Molecular Formula | C22H20BrNO4 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | (4-bromophenyl) 2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
| SMILES | CC1CCC2C(=O)N(c3ccccc3C(=O)Oc3ccc(Br)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C22H20BrNO4/c1-13-6-11-16-18(12-13)21(26)24(20(16)25)19-5-3-2-4-17(19)22(27)28-15-9-7-14(23)8-10-15/h2-5,7-10,13,16,18H,6,11-12H2,1H3 |
| InChIKey | SJJRVYSWKPDCEN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|