C21H18FNO4 — CID 2925343
[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-fluorobenzoate (PubChem CID 2925343) has the molecular formula C21H18FNO4 and a molecular weight of 367.38 g/mol. Its IUPAC name is [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-fluorobenzoate.
| Compound Name | [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 2925343 |
| Molecular Formula | C21H18FNO4 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-fluorobenzoate |
| SMILES | O=C(Oc1cccc(N2C(=O)C3CCCCC3C2=O)c1)c1ccccc1F |
| InChI | InChI=1S/C21H18FNO4/c22-18-11-4-3-10-17(18)21(26)27-14-7-5-6-13(12-14)23-19(24)15-8-1-2-9-16(15)20(23)25/h3-7,10-12,15-16H,1-2,8-9H2 |
| InChIKey | APPFBFFOOUICJQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|