About 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine
2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine (PubChem CID 29254) has the molecular formula C20H25NO
and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine |
| PubChem CID | 29254 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOC1c2ccccc2C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H25NO/c1-20(2)17-11-7-5-9-15(17)19(22-14-13-21(3)4)16-10-6-8-12-18(16)20/h5-12,19H,13-14H2,1-4H3 |
| InChIKey | VTELBPXZMLGAMU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine?
The IUPAC name of 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine (CID 29254) is 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine?
The canonical SMILES for 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine is CN(C)CCOC1c2ccccc2C(C)(C)c2ccccc21.
What is the InChIKey of 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine?
The InChIKey is VTELBPXZMLGAMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO/c1-20(2)17-11-7-5-9-15(17)19(22-14-13-21(3)4)16-10-6-8-12-18(16)20/h5-12,19H,13-14H2,1-4H3.
What are the key properties of 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine?
2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine has a molecular weight of 295.43 g/mol, XLogP of 3.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(10,10-dimethyl-9H-anthracen-9-yl)oxy]-N,N-dimethylethanamine is sourced from PubChem (CID 29254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).