C18H22N6O — CID 29254089
5-[(1S)-1-(3,5-dimethylpyrazol-1-yl)ethyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole (PubChem CID 29254089) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 5-[(1S)-1-(3,5-dimethylpyrazol-1-yl)ethyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole.
| Compound Name | 5-[(1S)-1-(3,5-dimethylpyrazol-1-yl)ethyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 29254089 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 5-[(1S)-1-(3,5-dimethylpyrazol-1-yl)ethyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(C)n([C@@H](C)c2nc(-c3c(C)ncc4c3CCNC4)no2)n1 |
| InChI | InChI=1S/C18H22N6O/c1-10-7-11(2)24(22-10)13(4)18-21-17(23-25-18)16-12(3)20-9-14-8-19-6-5-15(14)16/h7,9,13,19H,5-6,8H2,1-4H3/t13-/m0/s1 |
| InChIKey | KQZXMWIPUCOXTH-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |