C19H19F3N2O3 — CID 2925597
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 2925597) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 2925597 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)C2C3CCC(C3)C2C1=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H19F3N2O3/c20-19(21,22)12-3-1-2-4-13(12)23-14(25)7-8-24-17(26)15-10-5-6-11(9-10)16(15)18(24)27/h1-4,10-11,15-16H,5-9H2,(H,23,25) |
| InChIKey | HIMOTPAEFIRMHB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|